C10H18O2 — CID 101342690
(3S,4aR,8aS)-3-methoxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene (PubChem CID 101342690) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (3S,4aR,8aS)-3-methoxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene.
| Compound Name | (3S,4aR,8aS)-3-methoxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene |
|---|---|
| PubChem CID | 101342690 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3S,4aR,8aS)-3-methoxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene |
| SMILES | CO[C@@H]1C[C@H]2CCCC[C@@H]2CO1 |
| InChI | InChI=1S/C10H18O2/c1-11-10-6-8-4-2-3-5-9(8)7-12-10/h8-10H,2-7H2,1H3/t8-,9-,10+/m1/s1 |
| InChIKey | WRAJQRLRZVNTKE-BBBLOLIVSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |