C16H18O9 — CID 101342818
(1R,2S,3S,4aR,9aS)-1,2,3,4a,8,9a-hexahydroxy-6-methoxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione (PubChem CID 101342818) has the molecular formula C16H18O9 and a molecular weight of 354.31 g/mol. Its IUPAC name is (1R,2S,3S,4aR,9aS)-1,2,3,4a,8,9a-hexahydroxy-6-methoxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione.
| Compound Name | (1R,2S,3S,4aR,9aS)-1,2,3,4a,8,9a-hexahydroxy-6-methoxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione |
|---|---|
| PubChem CID | 101342818 |
| Molecular Formula | C16H18O9 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (1R,2S,3S,4aR,9aS)-1,2,3,4a,8,9a-hexahydroxy-6-methoxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione |
| SMILES | COc1cc(O)c2c(c1)C(=O)[C@@]1(O)C[C@](C)(O)[C@@H](O)[C@@H](O)[C@@]1(O)C2=O |
| InChI | InChI=1S/C16H18O9/c1-14(22)5-15(23)10(18)7-3-6(25-2)4-8(17)9(7)11(19)16(15,24)13(21)12(14)20/h3-4,12-13,17,20-24H,5H2,1-2H3/t12-,13+,14-,15-,16-/m0/s1 |
| InChIKey | XICPGXMHBSJNAL-QRJUGERDSA-N |
| XLogP | -1.88 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|