C21H22ClN5 — CID 10134352
3-chloro-4-(10-methyl-2-pentan-3-yl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-7-yl)benzonitrile (PubChem CID 10134352) has the molecular formula C21H22ClN5 and a molecular weight of 379.90 g/mol. Its IUPAC name is 3-chloro-4-(10-methyl-2-pentan-3-yl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-7-yl)benzonitrile.
| Compound Name | 3-chloro-4-(10-methyl-2-pentan-3-yl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-7-yl)benzonitrile |
|---|---|
| PubChem CID | 10134352 |
| Molecular Formula | C21H22ClN5 |
| Molecular Weight | 379.90 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-chloro-4-(10-methyl-2-pentan-3-yl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-7-yl)benzonitrile |
| SMILES | CCC(CC)n1cc2c3c(nc(C)nc31)N(c1ccc(C#N)cc1Cl)CC2 |
| InChI | InChI=1S/C21H22ClN5/c1-4-16(5-2)27-12-15-8-9-26(18-7-6-14(11-23)10-17(18)22)20-19(15)21(27)25-13(3)24-20/h6-7,10,12,16H,4-5,8-9H2,1-3H3 |
| InChIKey | FCKNYMJOHKWEJH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.90 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |