C26H24O4 — CID 101343536
benzyl (1S,2R,6R)-2-hydroxy-4-oxo-2,6-diphenylcyclohexane-1-carboxylate (PubChem CID 101343536) has the molecular formula C26H24O4 and a molecular weight of 400.47 g/mol. Its IUPAC name is benzyl (1S,2R,6R)-2-hydroxy-4-oxo-2,6-diphenylcyclohexane-1-carboxylate.
| Compound Name | benzyl (1S,2R,6R)-2-hydroxy-4-oxo-2,6-diphenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 101343536 |
| Molecular Formula | C26H24O4 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | benzyl (1S,2R,6R)-2-hydroxy-4-oxo-2,6-diphenylcyclohexane-1-carboxylate |
| SMILES | O=C1C[C@@H](c2ccccc2)[C@H](C(=O)OCc2ccccc2)[C@@](O)(c2ccccc2)C1 |
| InChI | InChI=1S/C26H24O4/c27-22-16-23(20-12-6-2-7-13-20)24(25(28)30-18-19-10-4-1-5-11-19)26(29,17-22)21-14-8-3-9-15-21/h1-15,23-24,29H,16-18H2/t23-,24+,26-/m0/s1 |
| InChIKey | XFDILNDRPMVNPC-GSLIJJQTSA-N |
| XLogP | 4.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |