About 2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one
2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one (PubChem CID 101343614) has the molecular formula C22H18FNO2
and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one.
Molecular Properties
| Compound Name | 2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one |
| PubChem CID | 101343614 |
| Molecular Formula | C22H18FNO2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one |
| SMILES | COC1(c2cccc3ccccc23)c2ccccc2C(=O)N1[C@H]1C[C@H]1F |
| InChI | InChI=1S/C22H18FNO2/c1-26-22(17-12-6-8-14-7-2-3-9-15(14)17)18-11-5-4-10-16(18)21(25)24(22)20-13-19(20)23/h2-12,19-20H,13H2,1H3/t19-,20+,22?/m1/s1 |
| InChIKey | YUCMOYOLXMNHOB-MFCMXAAESA-N |
| XLogP | 4.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one?
The IUPAC name of 2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one (CID 101343614) is 2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one.
What is the SMILES notation for 2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one?
The canonical SMILES for 2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one is COC1(c2cccc3ccccc23)c2ccccc2C(=O)N1[C@H]1C[C@H]1F.
What is the InChIKey of 2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one?
The InChIKey is YUCMOYOLXMNHOB-MFCMXAAESA-N. The full InChI is InChI=1S/C22H18FNO2/c1-26-22(17-12-6-8-14-7-2-3-9-15(14)17)18-11-5-4-10-16(18)21(25)24(22)20-13-19(20)23/h2-12,19-20H,13H2,1H3/t19-,20+,22?/m1/s1.
What are the key properties of 2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one?
2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one has a molecular weight of 347.39 g/mol, XLogP of 4.25, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2R)-2-fluorocyclopropyl]-3-methoxy-3-naphthalen-1-ylisoindol-1-one is sourced from PubChem (CID 101343614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).