C17H22O4 — CID 101343776
[(E)-3-[(1R,2R)-1-hydroxy-2-phenylcyclohexyl]prop-2-enyl] methyl carbonate (PubChem CID 101343776) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is [(E)-3-[(1R,2R)-1-hydroxy-2-phenylcyclohexyl]prop-2-enyl] methyl carbonate.
| Compound Name | [(E)-3-[(1R,2R)-1-hydroxy-2-phenylcyclohexyl]prop-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 101343776 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [(E)-3-[(1R,2R)-1-hydroxy-2-phenylcyclohexyl]prop-2-enyl] methyl carbonate |
| SMILES | COC(=O)OC/C=C/[C@]1(O)CCCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H22O4/c1-20-16(18)21-13-7-12-17(19)11-6-5-10-15(17)14-8-3-2-4-9-14/h2-4,7-9,12,15,19H,5-6,10-11,13H2,1H3/b12-7+/t15-,17-/m1/s1 |
| InChIKey | FLJPTSOAJJTKAG-JIQYMASRSA-N |
| XLogP | 3.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|