About [3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate
[3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate (PubChem CID 10134411) has the molecular formula C17H16N2O6
and a molecular weight of 344.32 g/mol. Its IUPAC name is [3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate.
Molecular Properties
| Compound Name | [3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate |
| PubChem CID | 10134411 |
| Molecular Formula | C17H16N2O6 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate |
| SMILES | CC(=O)Cc1ccccc1C(=O)OCc1ncccc1CO[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N2O6/c1-12(20)9-13-5-2-3-7-15(13)17(21)24-11-16-14(6-4-8-18-16)10-25-19(22)23/h2-8H,9-11H2,1H3 |
| InChIKey | MXXDDDUCHFIAEI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate?
The IUPAC name of [3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate (CID 10134411) is [3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate.
What is the SMILES notation for [3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate?
The canonical SMILES for [3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate is CC(=O)Cc1ccccc1C(=O)OCc1ncccc1CO[N+](=O)[O-].
What is the InChIKey of [3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate?
The InChIKey is MXXDDDUCHFIAEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O6/c1-12(20)9-13-5-2-3-7-15(13)17(21)24-11-16-14(6-4-8-18-16)10-25-19(22)23/h2-8H,9-11H2,1H3.
What are the key properties of [3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate?
[3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate has a molecular weight of 344.32 g/mol, XLogP of 2.28, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(nitrooxymethyl)-2-pyridinyl]methyl 2-(2-oxopropyl)benzoate is sourced from PubChem (CID 10134411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).