C17H14F3N3O2S — CID 10134426
4-[2-(3-methylphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide (PubChem CID 10134426) has the molecular formula C17H14F3N3O2S and a molecular weight of 381.38 g/mol. Its IUPAC name is 4-[2-(3-methylphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[2-(3-methylphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10134426 |
| Molecular Formula | C17H14F3N3O2S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 4-[2-(3-methylphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide |
| SMILES | Cc1cccc(-c2nc(C(F)(F)F)cn2-c2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C17H14F3N3O2S/c1-11-3-2-4-12(9-11)16-22-15(17(18,19)20)10-23(16)13-5-7-14(8-6-13)26(21,24)25/h2-10H,1H3,(H2,21,24,25) |
| InChIKey | LGLNOLKJZSIGPL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |