C17H32O3Si2 — CID 101344342
(2S,3R,4R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-trimethylsilylethynyl)-1-oxaspiro[2.4]heptan-7-ol (PubChem CID 101344342) has the molecular formula C17H32O3Si2 and a molecular weight of 340.61 g/mol. Its IUPAC name is (2S,3R,4R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-trimethylsilylethynyl)-1-oxaspiro[2.4]heptan-7-ol.
| Compound Name | (2S,3R,4R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-trimethylsilylethynyl)-1-oxaspiro[2.4]heptan-7-ol |
|---|---|
| PubChem CID | 101344342 |
| Molecular Formula | C17H32O3Si2 |
| Molecular Weight | 340.61 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (2S,3R,4R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-trimethylsilylethynyl)-1-oxaspiro[2.4]heptan-7-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@H](O)[C@]12O[C@H]2C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H32O3Si2/c1-16(2,3)22(7,8)20-15-10-9-13(18)17(15)14(19-17)11-12-21(4,5)6/h13-15,18H,9-10H2,1-8H3/t13-,14-,15+,17+/m0/s1 |
| InChIKey | YZXJXHKXPFYPTQ-LJIGWXMPSA-N |
| XLogP | 3.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|