C34H60I2O14 — CID 101344501
1,4-bis[2-[2-[2-[2-(2,2-diethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-2,5-diiodobenzene (PubChem CID 101344501) has the molecular formula C34H60I2O14 and a molecular weight of 946.65 g/mol. Its IUPAC name is 1,4-bis[2-[2-[2-[2-(2,2-diethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-2,5-diiodobenzene.
| Compound Name | 1,4-bis[2-[2-[2-[2-(2,2-diethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-2,5-diiodobenzene |
|---|---|
| PubChem CID | 101344501 |
| Molecular Formula | C34H60I2O14 |
| Molecular Weight | 946.65 g/mol |
| Exact Mass | 946.21 |
| IUPAC Name | 1,4-bis[2-[2-[2-[2-(2,2-diethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-2,5-diiodobenzene |
| SMILES | CCOC(COCCOCCOCCOCCOc1cc(I)c(OCCOCCOCCOCCOCC(OCC)OCC)cc1I)OCC |
| InChI | InChI=1S/C34H60I2O14/c1-5-45-33(46-6-2)27-43-19-17-39-11-9-37-13-15-41-21-23-49-31-25-30(36)32(26-29(31)35)50-24-22-42-16-14-38-10-12-40-18-20-44-28-34(47-7-3)48-8-4/h25-26,33-34H,5-24,27-28H2,1-4H3 |
| InChIKey | KPQARKYRAVZYNY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 129.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|