C22H22O5 — CID 101345425
(6R,7S)-4-[2-[(6R,7S)-6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]ethynyl]-5,6,7,8-tetrahydronaphthalene-1,6,7-triol (PubChem CID 101345425) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is (6R,7S)-4-[2-[(6R,7S)-6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]ethynyl]-5,6,7,8-tetrahydronaphthalene-1,6,7-triol.
| Compound Name | (6R,7S)-4-[2-[(6R,7S)-6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]ethynyl]-5,6,7,8-tetrahydronaphthalene-1,6,7-triol |
|---|---|
| PubChem CID | 101345425 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (6R,7S)-4-[2-[(6R,7S)-6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]ethynyl]-5,6,7,8-tetrahydronaphthalene-1,6,7-triol |
| SMILES | Oc1ccc(C#Cc2cccc3c2C[C@H](O)[C@H](O)C3)c2c1C[C@H](O)[C@H](O)C2 |
| InChI | InChI=1S/C22H22O5/c23-18-7-6-13(16-10-21(26)22(27)11-17(16)18)5-4-12-2-1-3-14-8-19(24)20(25)9-15(12)14/h1-3,6-7,19-27H,8-11H2/t19-,20+,21-,22+/m1/s1 |
| InChIKey | DPRZANBZJSHLDG-MBDNFAEBSA-N |
| XLogP | 0.43 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|