C12H12O2 — CID 101345428
(2R,3S)-5-ethynyl-1,2,3,4-tetrahydronaphthalene-2,3-diol (PubChem CID 101345428) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is (2R,3S)-5-ethynyl-1,2,3,4-tetrahydronaphthalene-2,3-diol.
| Compound Name | (2R,3S)-5-ethynyl-1,2,3,4-tetrahydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 101345428 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (2R,3S)-5-ethynyl-1,2,3,4-tetrahydronaphthalene-2,3-diol |
| SMILES | C#Cc1cccc2c1C[C@H](O)[C@H](O)C2 |
| InChI | InChI=1S/C12H12O2/c1-2-8-4-3-5-9-6-11(13)12(14)7-10(8)9/h1,3-5,11-14H,6-7H2/t11-,12+/m1/s1 |
| InChIKey | OKCCGACSEYFPHX-NEPJUHHUSA-N |
| XLogP | 0.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|