C25H25NO4S — CID 101345783
methyl 2-[[(4-methylphenyl)sulfonyl-prop-2-enylamino]-naphthalen-2-ylmethyl]prop-2-enoate (PubChem CID 101345783) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is methyl 2-[[(4-methylphenyl)sulfonyl-prop-2-enylamino]-naphthalen-2-ylmethyl]prop-2-enoate.
| Compound Name | methyl 2-[[(4-methylphenyl)sulfonyl-prop-2-enylamino]-naphthalen-2-ylmethyl]prop-2-enoate |
|---|---|
| PubChem CID | 101345783 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | methyl 2-[[(4-methylphenyl)sulfonyl-prop-2-enylamino]-naphthalen-2-ylmethyl]prop-2-enoate |
| SMILES | C=CCN(C(C(=C)C(=O)OC)c1ccc2ccccc2c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H25NO4S/c1-5-16-26(31(28,29)23-14-10-18(2)11-15-23)24(19(3)25(27)30-4)22-13-12-20-8-6-7-9-21(20)17-22/h5-15,17,24H,1,3,16H2,2,4H3 |
| InChIKey | JBRWDIGUXKMYQY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|