C20H32O — CID 101345915
(1S,3S,4R,4aS,8aS)-3,4,8,8a-tetramethyl-4-[(2E)-3-methylpenta-2,4-dienyl]-1,2,3,4a,5,6-hexahydronaphthalen-1-ol (PubChem CID 101345915) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (1S,3S,4R,4aS,8aS)-3,4,8,8a-tetramethyl-4-[(2E)-3-methylpenta-2,4-dienyl]-1,2,3,4a,5,6-hexahydronaphthalen-1-ol.
| Compound Name | (1S,3S,4R,4aS,8aS)-3,4,8,8a-tetramethyl-4-[(2E)-3-methylpenta-2,4-dienyl]-1,2,3,4a,5,6-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 101345915 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (1S,3S,4R,4aS,8aS)-3,4,8,8a-tetramethyl-4-[(2E)-3-methylpenta-2,4-dienyl]-1,2,3,4a,5,6-hexahydronaphthalen-1-ol |
| SMILES | C=C/C(C)=C/C[C@]1(C)[C@@H](C)C[C@H](O)[C@]2(C)C(C)=CCC[C@@H]12 |
| InChI | InChI=1S/C20H32O/c1-7-14(2)11-12-19(5)16(4)13-18(21)20(6)15(3)9-8-10-17(19)20/h7,9,11,16-18,21H,1,8,10,12-13H2,2-6H3/b14-11+/t16-,17-,18-,19+,20+/m0/s1 |
| InChIKey | DFMJXLDPHLWJDW-OGCSDPQDSA-N |
| XLogP | 5.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|