C17H16N6O3S — CID 10134610
4-[[5-amino-1-[(E)-3-phenylprop-2-enoyl]-1,2,4-triazol-3-yl]amino]benzenesulfonamide (PubChem CID 10134610) has the molecular formula C17H16N6O3S and a molecular weight of 384.42 g/mol. Its IUPAC name is 4-[[5-amino-1-[(E)-3-phenylprop-2-enoyl]-1,2,4-triazol-3-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[5-amino-1-[(E)-3-phenylprop-2-enoyl]-1,2,4-triazol-3-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 10134610 |
| Molecular Formula | C17H16N6O3S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 4-[[5-amino-1-[(E)-3-phenylprop-2-enoyl]-1,2,4-triazol-3-yl]amino]benzenesulfonamide |
| SMILES | Nc1nc(Nc2ccc(S(N)(=O)=O)cc2)nn1C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H16N6O3S/c18-16-21-17(20-13-7-9-14(10-8-13)27(19,25)26)22-23(16)15(24)11-6-12-4-2-1-3-5-12/h1-11H,(H2,19,25,26)(H3,18,20,21,22)/b11-6+ |
| InChIKey | JNRBGGBTKUJYAT-IZZDOVSWSA-N |
| XLogP | 1.60 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|