C29H46O6Si — CID 101346154
methyl (E,7Z)-7-[(2S)-2-acetyloxy-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-ylidene]-4-triethylsilyloxyhept-5-enoate (PubChem CID 101346154) has the molecular formula C29H46O6Si and a molecular weight of 518.77 g/mol. Its IUPAC name is methyl (E,7Z)-7-[(2S)-2-acetyloxy-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-ylidene]-4-triethylsilyloxyhept-5-enoate.
| Compound Name | methyl (E,7Z)-7-[(2S)-2-acetyloxy-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-ylidene]-4-triethylsilyloxyhept-5-enoate |
|---|---|
| PubChem CID | 101346154 |
| Molecular Formula | C29H46O6Si |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | methyl (E,7Z)-7-[(2S)-2-acetyloxy-2-[(E)-oct-2-enyl]-5-oxocyclopent-3-en-1-ylidene]-4-triethylsilyloxyhept-5-enoate |
| SMILES | CCCCC/C=C/C[C@]1(OC(C)=O)C=CC(=O)/C1=C\C=C\C(CCC(=O)OC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C29H46O6Si/c1-7-11-12-13-14-15-22-29(34-24(5)30)23-21-27(31)26(29)18-16-17-25(19-20-28(32)33-6)35-36(8-2,9-3)10-4/h14-18,21,23,25H,7-13,19-20,22H2,1-6H3/b15-14+,17-16+,26-18+/t25?,29-/m0/s1 |
| InChIKey | ZDJCSTOYFOSIHU-NIYXLFFZSA-N |
| XLogP | 6.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|