C33H20Cl2NNaO7 — CID 101346256
sodium (3'S,4'R,5'S)-4'-[(4-benzoylphenyl)carbamoyl]-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylate (PubChem CID 101346256) has the molecular formula C33H20Cl2NNaO7 and a molecular weight of 636.42 g/mol. Its IUPAC name is sodium (3'S,4'R,5'S)-4'-[(4-benzoylphenyl)carbamoyl]-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylate.
| Compound Name | sodium (3'S,4'R,5'S)-4'-[(4-benzoylphenyl)carbamoyl]-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylate |
|---|---|
| PubChem CID | 101346256 |
| Molecular Formula | C33H20Cl2NNaO7 |
| Molecular Weight | 636.42 g/mol |
| Exact Mass | 635.05 |
| IUPAC Name | sodium (3'S,4'R,5'S)-4'-[(4-benzoylphenyl)carbamoyl]-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylate |
| SMILES | O=C(c1ccccc1)c1ccc(NC(=O)[C@H]2[C@@H](c3ccc(Cl)c(Cl)c3)OC3(C(=O)c4ccccc4C3=O)[C@H]2C(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C33H21Cl2NO7.Na/c34-23-15-12-19(16-24(23)35)28-25(26(32(41)42)33(43-28)29(38)21-8-4-5-9-22(21)30(33)39)31(40)36-20-13-10-18(11-14-20)27(37)17-6-2-1-3-7-17;/h1-16,25-26,28H,(H,36,40)(H,41,42);/q;+1/p-1/t25-,26-,28-;/m1./s1 |
| InChIKey | PXTJQRLJCSYFHT-LIPUJHLTSA-M |
| XLogP | 1.74 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|