About (4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one
(4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (PubChem CID 101346715) has the molecular formula C16H8ClF3N2O2
and a molecular weight of 352.70 g/mol. Its IUPAC name is (4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one.
Molecular Properties
| Compound Name | (4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| PubChem CID | 101346715 |
| Molecular Formula | C16H8ClF3N2O2 |
| Molecular Weight | 352.70 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | (4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2[C@@](C#Cc2cccnc2)(C(F)(F)F)O1 |
| InChI | InChI=1S/C16H8ClF3N2O2/c17-11-3-4-13-12(8-11)15(16(18,19)20,24-14(23)22-13)6-5-10-2-1-7-21-9-10/h1-4,7-9H,(H,22,23)/t15-/m0/s1 |
| InChIKey | OXQJMVDTEDZLCW-HNNXBMFYSA-N |
| XLogP | 4.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.70 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
The IUPAC name of (4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CID 101346715) is (4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one.
What is the SMILES notation for (4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
The canonical SMILES for (4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one is O=C1Nc2ccc(Cl)cc2[C@@](C#Cc2cccnc2)(C(F)(F)F)O1.
What is the InChIKey of (4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
The InChIKey is OXQJMVDTEDZLCW-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H8ClF3N2O2/c17-11-3-4-13-12(8-11)15(16(18,19)20,24-14(23)22-13)6-5-10-2-1-7-21-9-10/h1-4,7-9H,(H,22,23)/t15-/m0/s1.
What are the key properties of (4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
(4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one has a molecular weight of 352.70 g/mol, XLogP of 4.11, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-6-chloro-4-(2-pyridin-3-ylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one is sourced from PubChem (CID 101346715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).