C16H32O4Si — CID 101346900
(4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-propan-2-yl-1,3-dioxane-4-carbaldehyde (PubChem CID 101346900) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is (4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-propan-2-yl-1,3-dioxane-4-carbaldehyde.
| Compound Name | (4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-propan-2-yl-1,3-dioxane-4-carbaldehyde |
|---|---|
| PubChem CID | 101346900 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-propan-2-yl-1,3-dioxane-4-carbaldehyde |
| SMILES | CC(C)[C@H]1OC(C)(C)O[C@@H](C=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O4Si/c1-11(2)13-14(20-21(8,9)15(3,4)5)12(10-17)18-16(6,7)19-13/h10-14H,1-9H3/t12-,13+,14-/m0/s1 |
| InChIKey | ANAMUZJBYRXIQJ-MJBXVCDLSA-N |
| XLogP | 3.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|