About 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide
3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 10134701) has the molecular formula C19H16ClN3O4
and a molecular weight of 385.81 g/mol. Its IUPAC name is 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide |
| PubChem CID | 10134701 |
| Molecular Formula | C19H16ClN3O4 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(Cl)cc(Nc2c(Nc3ccccc3)c(=O)c2=O)c1O |
| InChI | InChI=1S/C19H16ClN3O4/c1-23(2)19(27)12-8-10(20)9-13(16(12)24)22-15-14(17(25)18(15)26)21-11-6-4-3-5-7-11/h3-9,21-22,24H,1-2H3 |
| InChIKey | JMUNTWLFBDHKSN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide?
The IUPAC name of 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide (CID 10134701) is 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide.
What is the SMILES notation for 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide?
The canonical SMILES for 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide is CN(C)C(=O)c1cc(Cl)cc(Nc2c(Nc3ccccc3)c(=O)c2=O)c1O.
What is the InChIKey of 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide?
The InChIKey is JMUNTWLFBDHKSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClN3O4/c1-23(2)19(27)12-8-10(20)9-13(16(12)24)22-15-14(17(25)18(15)26)21-11-6-4-3-5-7-11/h3-9,21-22,24H,1-2H3.
What are the key properties of 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide?
3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide has a molecular weight of 385.81 g/mol, XLogP of 2.83, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-5-chloro-2-hydroxy-N,N-dimethylbenzamide is sourced from PubChem (CID 10134701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).