C11H13F3N2O2 — CID 101347112
1-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydroquinazoline-2,4-dione (PubChem CID 101347112) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 1-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydroquinazoline-2,4-dione.
| Compound Name | 1-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 101347112 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydroquinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CCC(F)(F)F)c2c1CCCC2 |
| InChI | InChI=1S/C11H13F3N2O2/c12-11(13,14)5-6-16-8-4-2-1-3-7(8)9(17)15-10(16)18/h1-6H2,(H,15,17,18) |
| InChIKey | OJOPGVJCIBJDRK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |