C17H36O3Si — CID 101347212
(2R,3R,4R)-2,4-dimethyl-5-[(2-methylpropan-2-yl)oxy]-3-triethylsilyloxypentanal (PubChem CID 101347212) has the molecular formula C17H36O3Si and a molecular weight of 316.56 g/mol. Its IUPAC name is (2R,3R,4R)-2,4-dimethyl-5-[(2-methylpropan-2-yl)oxy]-3-triethylsilyloxypentanal.
| Compound Name | (2R,3R,4R)-2,4-dimethyl-5-[(2-methylpropan-2-yl)oxy]-3-triethylsilyloxypentanal |
|---|---|
| PubChem CID | 101347212 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (2R,3R,4R)-2,4-dimethyl-5-[(2-methylpropan-2-yl)oxy]-3-triethylsilyloxypentanal |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@H](C)COC(C)(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C17H36O3Si/c1-9-21(10-2,11-3)20-16(14(4)12-18)15(5)13-19-17(6,7)8/h12,14-16H,9-11,13H2,1-8H3/t14-,15+,16-/m0/s1 |
| InChIKey | KIFCHPNMBMOSFY-XHSDSOJGSA-N |
| XLogP | 4.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|