C26H36O3Si — CID 101347945
(Z,1S)-1-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]-7-tri(propan-2-yl)silylhept-4-en-2,6-diyn-1-ol (PubChem CID 101347945) has the molecular formula C26H36O3Si and a molecular weight of 424.66 g/mol. Its IUPAC name is (Z,1S)-1-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]-7-tri(propan-2-yl)silylhept-4-en-2,6-diyn-1-ol.
| Compound Name | (Z,1S)-1-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]-7-tri(propan-2-yl)silylhept-4-en-2,6-diyn-1-ol |
|---|---|
| PubChem CID | 101347945 |
| Molecular Formula | C26H36O3Si |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (Z,1S)-1-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]-7-tri(propan-2-yl)silylhept-4-en-2,6-diyn-1-ol |
| SMILES | CC(C)[Si](C#C/C=C\C#C[C@H](O)[C@@H]1CCO[C@H](c2ccccc2)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H36O3Si/c1-20(2)30(21(3)4,22(5)6)19-13-8-7-12-16-24(27)25-17-18-28-26(29-25)23-14-10-9-11-15-23/h7-11,14-15,20-22,24-27H,17-18H2,1-6H3/b8-7-/t24-,25-,26-/m0/s1 |
| InChIKey | WADFWONJJZERNR-RETHYWTRSA-N |
| XLogP | 5.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|