About 3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide
3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide (PubChem CID 101348063) has the molecular formula C13H9N7S
and a molecular weight of 295.33 g/mol. Its IUPAC name is 3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide.
Molecular Properties
| Compound Name | 3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide |
| PubChem CID | 101348063 |
| Molecular Formula | C13H9N7S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide |
| SMILES | N#CC1=C(N)N(C(=S)Nc2ccccc2)NC1(C#N)C#N |
| InChI | InChI=1S/C13H9N7S/c14-6-10-11(17)20(19-13(10,7-15)8-16)12(21)18-9-4-2-1-3-5-9/h1-5,19H,17H2,(H,18,21) |
| InChIKey | OMLGQUHDAHLIDY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide?
The IUPAC name of 3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide (CID 101348063) is 3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide.
What is the SMILES notation for 3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide?
The canonical SMILES for 3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide is N#CC1=C(N)N(C(=S)Nc2ccccc2)NC1(C#N)C#N.
What is the InChIKey of 3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide?
The InChIKey is OMLGQUHDAHLIDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N7S/c14-6-10-11(17)20(19-13(10,7-15)8-16)12(21)18-9-4-2-1-3-5-9/h1-5,19H,17H2,(H,18,21).
What are the key properties of 3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide?
3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide has a molecular weight of 295.33 g/mol, XLogP of 0.68, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,5,5-tricyano-N-phenyl-1H-pyrazole-2-carbothioamide is sourced from PubChem (CID 101348063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).