About N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide
N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide (PubChem CID 10134835) has the molecular formula C25H29N3O
and a molecular weight of 387.53 g/mol. Its IUPAC name is N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide |
| PubChem CID | 10134835 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide |
| SMILES | Cc1ccc(-c2nc(C(=O)NC3CCCCC3)n(C)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H29N3O/c1-17-9-13-19(14-10-17)22-23(20-15-11-18(2)12-16-20)28(3)24(27-22)25(29)26-21-7-5-4-6-8-21/h9-16,21H,4-8H2,1-3H3,(H,26,29) |
| InChIKey | ZXRHTIKQXHNMFB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide?
The IUPAC name of N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide (CID 10134835) is N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide.
What is the SMILES notation for N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide?
The canonical SMILES for N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide is Cc1ccc(-c2nc(C(=O)NC3CCCCC3)n(C)c2-c2ccc(C)cc2)cc1.
What is the InChIKey of N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide?
The InChIKey is ZXRHTIKQXHNMFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N3O/c1-17-9-13-19(14-10-17)22-23(20-15-11-18(2)12-16-20)28(3)24(27-22)25(29)26-21-7-5-4-6-8-21/h9-16,21H,4-8H2,1-3H3,(H,26,29).
What are the key properties of N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide?
N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide has a molecular weight of 387.53 g/mol, XLogP of 5.43, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxamide is sourced from PubChem (CID 10134835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).