About 2-octoxy-6-octyl-3,1-benzoxazin-4-one
2-octoxy-6-octyl-3,1-benzoxazin-4-one (PubChem CID 10134838) has the molecular formula C24H37NO3
and a molecular weight of 387.56 g/mol. Its IUPAC name is 2-octoxy-6-octyl-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-octoxy-6-octyl-3,1-benzoxazin-4-one |
| PubChem CID | 10134838 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | 2-octoxy-6-octyl-3,1-benzoxazin-4-one |
| SMILES | CCCCCCCCOc1nc2ccc(CCCCCCCC)cc2c(=O)o1 |
| InChI | InChI=1S/C24H37NO3/c1-3-5-7-9-11-13-15-20-16-17-22-21(19-20)23(26)28-24(25-22)27-18-14-12-10-8-6-4-2/h16-17,19H,3-15,18H2,1-2H3 |
| InChIKey | YDGMSSJFEFLXLA-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octoxy-6-octyl-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octoxy-6-octyl-3,1-benzoxazin-4-one?
The IUPAC name of 2-octoxy-6-octyl-3,1-benzoxazin-4-one (CID 10134838) is 2-octoxy-6-octyl-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-octoxy-6-octyl-3,1-benzoxazin-4-one?
The canonical SMILES for 2-octoxy-6-octyl-3,1-benzoxazin-4-one is CCCCCCCCOc1nc2ccc(CCCCCCCC)cc2c(=O)o1.
What is the InChIKey of 2-octoxy-6-octyl-3,1-benzoxazin-4-one?
The InChIKey is YDGMSSJFEFLXLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H37NO3/c1-3-5-7-9-11-13-15-20-16-17-22-21(19-20)23(26)28-24(25-22)27-18-14-12-10-8-6-4-2/h16-17,19H,3-15,18H2,1-2H3.
What are the key properties of 2-octoxy-6-octyl-3,1-benzoxazin-4-one?
2-octoxy-6-octyl-3,1-benzoxazin-4-one has a molecular weight of 387.56 g/mol, XLogP of 6.83, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octoxy-6-octyl-3,1-benzoxazin-4-one is sourced from PubChem (CID 10134838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).