C27H40O5S — CID 101348384
(1S,2R,3R,5S,6R)-6-(methoxymethoxy)-2-[(1S)-1-(methoxymethoxy)but-3-enyl]-2-methyl-3-phenylsulfanyl-1,5-bis(prop-1-en-2-yl)cyclohexan-1-ol (PubChem CID 101348384) has the molecular formula C27H40O5S and a molecular weight of 476.68 g/mol. Its IUPAC name is (1S,2R,3R,5S,6R)-6-(methoxymethoxy)-2-[(1S)-1-(methoxymethoxy)but-3-enyl]-2-methyl-3-phenylsulfanyl-1,5-bis(prop-1-en-2-yl)cyclohexan-1-ol.
| Compound Name | (1S,2R,3R,5S,6R)-6-(methoxymethoxy)-2-[(1S)-1-(methoxymethoxy)but-3-enyl]-2-methyl-3-phenylsulfanyl-1,5-bis(prop-1-en-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 101348384 |
| Molecular Formula | C27H40O5S |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | (1S,2R,3R,5S,6R)-6-(methoxymethoxy)-2-[(1S)-1-(methoxymethoxy)but-3-enyl]-2-methyl-3-phenylsulfanyl-1,5-bis(prop-1-en-2-yl)cyclohexan-1-ol |
| SMILES | C=CC[C@H](OCOC)[C@@]1(C)[C@H](Sc2ccccc2)C[C@@H](C(=C)C)[C@@H](OCOC)[C@]1(O)C(=C)C |
| InChI | InChI=1S/C27H40O5S/c1-9-13-23(31-17-29-7)26(6)24(33-21-14-11-10-12-15-21)16-22(19(2)3)25(32-18-30-8)27(26,28)20(4)5/h9-12,14-15,22-25,28H,1-2,4,13,16-18H2,3,5-8H3/t22-,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | FAMLKBWAPPACGS-GGSNJDJHSA-N |
| XLogP | 5.61 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|