C25H36O5S — CID 101348386
(1R,3S,4R,4aS,8S,8aR)-4,8-bis(methoxymethoxy)-5,8a-dimethyl-1-phenylsulfanyl-3-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-4a-ol (PubChem CID 101348386) has the molecular formula C25H36O5S and a molecular weight of 448.63 g/mol. Its IUPAC name is (1R,3S,4R,4aS,8S,8aR)-4,8-bis(methoxymethoxy)-5,8a-dimethyl-1-phenylsulfanyl-3-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-4a-ol.
| Compound Name | (1R,3S,4R,4aS,8S,8aR)-4,8-bis(methoxymethoxy)-5,8a-dimethyl-1-phenylsulfanyl-3-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-4a-ol |
|---|---|
| PubChem CID | 101348386 |
| Molecular Formula | C25H36O5S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (1R,3S,4R,4aS,8S,8aR)-4,8-bis(methoxymethoxy)-5,8a-dimethyl-1-phenylsulfanyl-3-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-4a-ol |
| SMILES | C=C(C)[C@@H]1C[C@@H](Sc2ccccc2)[C@]2(C)[C@@H](OCOC)CC=C(C)[C@@]2(O)[C@@H]1OCOC |
| InChI | InChI=1S/C25H36O5S/c1-17(2)20-14-22(31-19-10-8-7-9-11-19)24(4)21(29-15-27-5)13-12-18(3)25(24,26)23(20)30-16-28-6/h7-12,20-23,26H,1,13-16H2,2-6H3/t20-,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | SWJFTIHIDQIEHL-JXQUOSBXSA-N |
| XLogP | 4.81 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|