C24H28O11 — CID 101348793
trimethyl (1R,2R,3R,4R,5S)-2-hydroxy-2-(2-methoxy-2-oxoethyl)-4-[(E)-2-(4-methoxyphenyl)ethenyl]-6-oxocyclohexane-1,3,5-tricarboxylate (PubChem CID 101348793) has the molecular formula C24H28O11 and a molecular weight of 492.48 g/mol. Its IUPAC name is trimethyl (1R,2R,3R,4R,5S)-2-hydroxy-2-(2-methoxy-2-oxoethyl)-4-[(E)-2-(4-methoxyphenyl)ethenyl]-6-oxocyclohexane-1,3,5-tricarboxylate.
| Compound Name | trimethyl (1R,2R,3R,4R,5S)-2-hydroxy-2-(2-methoxy-2-oxoethyl)-4-[(E)-2-(4-methoxyphenyl)ethenyl]-6-oxocyclohexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 101348793 |
| Molecular Formula | C24H28O11 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | trimethyl (1R,2R,3R,4R,5S)-2-hydroxy-2-(2-methoxy-2-oxoethyl)-4-[(E)-2-(4-methoxyphenyl)ethenyl]-6-oxocyclohexane-1,3,5-tricarboxylate |
| SMILES | COC(=O)C[C@]1(O)[C@@H](C(=O)OC)C(=O)[C@@H](C(=O)OC)C(/C=C/c2ccc(OC)cc2)[C@H]1C(=O)OC |
| InChI | InChI=1S/C24H28O11/c1-31-14-9-6-13(7-10-14)8-11-15-17(21(27)33-3)20(26)19(23(29)35-5)24(30,12-16(25)32-2)18(15)22(28)34-4/h6-11,15,17-19,30H,12H2,1-5H3/b11-8+/t15?,17-,18-,19+,24+/m0/s1 |
| InChIKey | YRYWSNXIOOFGJJ-OLQNNFTISA-N |
| XLogP | 0.57 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|