C20H30O6 — CID 101349382
dimethyl (3aS,4R,6Z,9R,9aR)-5',5'-dimethylspiro[1,3,3a,4,5,8,9,9a-octahydrocyclopenta[8]annulene-2,2'-1,3-dioxane]-4,9-dicarboxylate (PubChem CID 101349382) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is dimethyl (3aS,4R,6Z,9R,9aR)-5',5'-dimethylspiro[1,3,3a,4,5,8,9,9a-octahydrocyclopenta[8]annulene-2,2'-1,3-dioxane]-4,9-dicarboxylate.
| Compound Name | dimethyl (3aS,4R,6Z,9R,9aR)-5',5'-dimethylspiro[1,3,3a,4,5,8,9,9a-octahydrocyclopenta[8]annulene-2,2'-1,3-dioxane]-4,9-dicarboxylate |
|---|---|
| PubChem CID | 101349382 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | dimethyl (3aS,4R,6Z,9R,9aR)-5',5'-dimethylspiro[1,3,3a,4,5,8,9,9a-octahydrocyclopenta[8]annulene-2,2'-1,3-dioxane]-4,9-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C/C=C\C[C@@H](C(=O)OC)[C@H]2CC3(C[C@H]21)OCC(C)(C)CO3 |
| InChI | InChI=1S/C20H30O6/c1-19(2)11-25-20(26-12-19)9-15-13(17(21)23-3)7-5-6-8-14(16(15)10-20)18(22)24-4/h5-6,13-16H,7-12H2,1-4H3/b6-5-/t13-,14-,15-,16+/m1/s1 |
| InChIKey | HIKMKHFXPCRXGA-GKEZSVGLSA-N |
| XLogP | 2.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|