C15H24 — CID 101349815
(1Z,4Z,8Z)-1,3,3,8-tetramethylcycloundeca-1,4,8-triene (PubChem CID 101349815) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is (1Z,4Z,8Z)-1,3,3,8-tetramethylcycloundeca-1,4,8-triene.
| Compound Name | (1Z,4Z,8Z)-1,3,3,8-tetramethylcycloundeca-1,4,8-triene |
|---|---|
| PubChem CID | 101349815 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (1Z,4Z,8Z)-1,3,3,8-tetramethylcycloundeca-1,4,8-triene |
| SMILES | C/C1=C/CC/C(C)=C\C(C)(C)/C=C\CC1 |
| InChI | InChI=1S/C15H24/c1-13-8-5-6-11-15(3,4)12-14(2)10-7-9-13/h6,9,11-12H,5,7-8,10H2,1-4H3/b11-6-,13-9-,14-12- |
| InChIKey | RTIZXJCGCGLKCH-JGKOJNDLSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|