C18H14F13NO — CID 101349979
4-[(Z)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloct-1-en-2-yl]morpholine (PubChem CID 101349979) has the molecular formula C18H14F13NO and a molecular weight of 507.29 g/mol. Its IUPAC name is 4-[(Z)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloct-1-en-2-yl]morpholine.
| Compound Name | 4-[(Z)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloct-1-en-2-yl]morpholine |
|---|---|
| PubChem CID | 101349979 |
| Molecular Formula | C18H14F13NO |
| Molecular Weight | 507.29 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | 4-[(Z)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloct-1-en-2-yl]morpholine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)/C(=C/c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C18H14F13NO/c19-13(20,12(32-6-8-33-9-7-32)10-11-4-2-1-3-5-11)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)31/h1-5,10H,6-9H2/b12-10- |
| InChIKey | BSTVZHJVTVGGQG-BENRWUELSA-N |
| XLogP | 6.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.29 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|