C19H39BO2Si — CID 101350024
tri(propan-2-yl)-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]silane (PubChem CID 101350024) has the molecular formula C19H39BO2Si and a molecular weight of 338.42 g/mol. Its IUPAC name is tri(propan-2-yl)-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]silane.
| Compound Name | tri(propan-2-yl)-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]silane |
|---|---|
| PubChem CID | 101350024 |
| Molecular Formula | C19H39BO2Si |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | tri(propan-2-yl)-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]silane |
| SMILES | C/C(=C\C[Si](C(C)C)(C(C)C)C(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H39BO2Si/c1-14(2)23(15(3)4,16(5)6)13-12-17(7)20-21-18(8,9)19(10,11)22-20/h12,14-16H,13H2,1-11H3/b17-12+ |
| InChIKey | VNBVATAXRBKAAL-SFQUDFHCSA-N |
| XLogP | 6.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|