C17H29BO6 — CID 101350025
[(E)-7-acetyloxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-enyl] acetate (PubChem CID 101350025) has the molecular formula C17H29BO6 and a molecular weight of 340.23 g/mol. Its IUPAC name is [(E)-7-acetyloxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-enyl] acetate.
| Compound Name | [(E)-7-acetyloxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-enyl] acetate |
|---|---|
| PubChem CID | 101350025 |
| Molecular Formula | C17H29BO6 |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | [(E)-7-acetyloxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-enyl] acetate |
| SMILES | CC(=O)OCCCC/C=C(/COC(C)=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H29BO6/c1-13(19)21-11-9-7-8-10-15(12-22-14(2)20)18-23-16(3,4)17(5,6)24-18/h10H,7-9,11-12H2,1-6H3/b15-10- |
| InChIKey | PDCCMTNFRAKDBP-GDNBJRDFSA-N |
| XLogP | 2.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|