C23H45BO5Si — CID 101350030
[(Z)-9-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)non-5-enyl] acetate (PubChem CID 101350030) has the molecular formula C23H45BO5Si and a molecular weight of 440.51 g/mol. Its IUPAC name is [(Z)-9-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)non-5-enyl] acetate.
| Compound Name | [(Z)-9-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)non-5-enyl] acetate |
|---|---|
| PubChem CID | 101350030 |
| Molecular Formula | C23H45BO5Si |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | [(Z)-9-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)non-5-enyl] acetate |
| SMILES | CC(=O)OCCCC/C=C(\CCCO[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H45BO5Si/c1-19(25)26-17-13-11-12-15-20(24-28-22(5,6)23(7,8)29-24)16-14-18-27-30(9,10)21(2,3)4/h15H,11-14,16-18H2,1-10H3/b20-15+ |
| InChIKey | WPKUKAHVQVYZSL-HMMYKYKNSA-N |
| XLogP | 6.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|