C18H18N2O4 — CID 101350086
2-hydroxy-N-[(1S)-2-hydroxy-1-(4-hydroxyphenyl)ethyl]-2-(1H-indol-3-yl)acetamide (PubChem CID 101350086) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-hydroxy-N-[(1S)-2-hydroxy-1-(4-hydroxyphenyl)ethyl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | 2-hydroxy-N-[(1S)-2-hydroxy-1-(4-hydroxyphenyl)ethyl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 101350086 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-hydroxy-N-[(1S)-2-hydroxy-1-(4-hydroxyphenyl)ethyl]-2-(1H-indol-3-yl)acetamide |
| SMILES | O=C(N[C@H](CO)c1ccc(O)cc1)C(O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H18N2O4/c21-10-16(11-5-7-12(22)8-6-11)20-18(24)17(23)14-9-19-15-4-2-1-3-13(14)15/h1-9,16-17,19,21-23H,10H2,(H,20,24)/t16-,17?/m1/s1 |
| InChIKey | ASSZRPNNBRGADU-TZHYSIJRSA-N |
| XLogP | 1.76 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |