C36H29N3O3 — CID 101350116
4-[[3,5-bis(phenylmethoxy)phenyl]methoxy]-2,6-dipyridin-2-ylpyridine (PubChem CID 101350116) has the molecular formula C36H29N3O3 and a molecular weight of 551.65 g/mol. Its IUPAC name is 4-[[3,5-bis(phenylmethoxy)phenyl]methoxy]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[[3,5-bis(phenylmethoxy)phenyl]methoxy]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 101350116 |
| Molecular Formula | C36H29N3O3 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 4-[[3,5-bis(phenylmethoxy)phenyl]methoxy]-2,6-dipyridin-2-ylpyridine |
| SMILES | c1ccc(COc2cc(COc3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C36H29N3O3/c1-3-11-27(12-4-1)24-40-30-19-29(20-31(21-30)41-25-28-13-5-2-6-14-28)26-42-32-22-35(33-15-7-9-17-37-33)39-36(23-32)34-16-8-10-18-38-34/h1-23H,24-26H2 |
| InChIKey | JSIYMGUVQQXQSF-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |