C19H38O4Si — CID 101350385
tert-butyl [(3R)-8-[tert-butyl(dimethyl)silyl]oxyoct-1-en-3-yl] carbonate (PubChem CID 101350385) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is tert-butyl [(3R)-8-[tert-butyl(dimethyl)silyl]oxyoct-1-en-3-yl] carbonate.
| Compound Name | tert-butyl [(3R)-8-[tert-butyl(dimethyl)silyl]oxyoct-1-en-3-yl] carbonate |
|---|---|
| PubChem CID | 101350385 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | tert-butyl [(3R)-8-[tert-butyl(dimethyl)silyl]oxyoct-1-en-3-yl] carbonate |
| SMILES | C=C[C@@H](CCCCCO[Si](C)(C)C(C)(C)C)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H38O4Si/c1-10-16(22-17(20)23-18(2,3)4)14-12-11-13-15-21-24(8,9)19(5,6)7/h10,16H,1,11-15H2,2-9H3/t16-/m0/s1 |
| InChIKey | OCWXGIMFOQSLAF-INIZCTEOSA-N |
| XLogP | 6.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|