C21H26FNO3S — CID 10135069
4-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]butan-1-ol (PubChem CID 10135069) has the molecular formula C21H26FNO3S and a molecular weight of 391.51 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]butan-1-ol.
| Compound Name | 4-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 10135069 |
| Molecular Formula | C21H26FNO3S |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]butan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2C(CCCCO)CCC2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H26FNO3S/c1-16-5-12-20(13-6-16)27(25,26)23-19(4-2-3-15-24)11-14-21(23)17-7-9-18(22)10-8-17/h5-10,12-13,19,21,24H,2-4,11,14-15H2,1H3 |
| InChIKey | XELWWSULVWYGAK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|