C17H22N2O4 — CID 101351226
(3S,4R,10aR)-3-(1,3-benzodioxol-5-yl)-4-methoxy-2,3,4,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepin-5-one (PubChem CID 101351226) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is (3S,4R,10aR)-3-(1,3-benzodioxol-5-yl)-4-methoxy-2,3,4,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepin-5-one.
| Compound Name | (3S,4R,10aR)-3-(1,3-benzodioxol-5-yl)-4-methoxy-2,3,4,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 101351226 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (3S,4R,10aR)-3-(1,3-benzodioxol-5-yl)-4-methoxy-2,3,4,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepin-5-one |
| SMILES | CO[C@H]1C(=O)N2CCCC[C@@H]2CN[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H22N2O4/c1-21-16-15(11-5-6-13-14(8-11)23-10-22-13)18-9-12-4-2-3-7-19(12)17(16)20/h5-6,8,12,15-16,18H,2-4,7,9-10H2,1H3/t12-,15+,16-/m1/s1 |
| InChIKey | XRQRDGNOBAZECL-UHOFOFEASA-N |
| XLogP | 1.46 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |