C27H25N3O3 — CID 101351228
2-[(3R,4S,10aS)-3-naphthalen-2-yl-5-oxo-2,3,4,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepin-4-yl]isoindole-1,3-dione (PubChem CID 101351228) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-[(3R,4S,10aS)-3-naphthalen-2-yl-5-oxo-2,3,4,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepin-4-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3R,4S,10aS)-3-naphthalen-2-yl-5-oxo-2,3,4,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepin-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 101351228 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 2-[(3R,4S,10aS)-3-naphthalen-2-yl-5-oxo-2,3,4,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepin-4-yl]isoindole-1,3-dione |
| SMILES | O=C1[C@@H](N2C(=O)c3ccccc3C2=O)[C@@H](c2ccc3ccccc3c2)NC[C@@H]2CCCCN12 |
| InChI | InChI=1S/C27H25N3O3/c31-25-21-10-3-4-11-22(21)26(32)30(25)24-23(19-13-12-17-7-1-2-8-18(17)15-19)28-16-20-9-5-6-14-29(20)27(24)33/h1-4,7-8,10-13,15,20,23-24,28H,5-6,9,14,16H2/t20-,23+,24-/m0/s1 |
| InChIKey | BVFUDKLGMISAGJ-ZTCOLXNVSA-N |
| XLogP | 3.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|