C24H32N4O — CID 10135149
10-(4-methoxy-2,6-dimethylphenyl)-N,N-dipropyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 10135149) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is 10-(4-methoxy-2,6-dimethylphenyl)-N,N-dipropyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 10-(4-methoxy-2,6-dimethylphenyl)-N,N-dipropyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 10135149 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 10-(4-methoxy-2,6-dimethylphenyl)-N,N-dipropyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCCN(CCC)c1c2c(nc3c(-c4c(C)cc(OC)cc4C)cnn13)CCC2 |
| InChI | InChI=1S/C24H32N4O/c1-6-11-27(12-7-2)24-19-9-8-10-21(19)26-23-20(15-25-28(23)24)22-16(3)13-18(29-5)14-17(22)4/h13-15H,6-12H2,1-5H3 |
| InChIKey | FKYIGVBMIMWCGZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |