C20H35NO2 — CID 101351566
(1S,3Z)-3-[(E,2R)-7-hydroxy-2,5-dimethyloct-4-enylidene]-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol (PubChem CID 101351566) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is (1S,3Z)-3-[(E,2R)-7-hydroxy-2,5-dimethyloct-4-enylidene]-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol.
| Compound Name | (1S,3Z)-3-[(E,2R)-7-hydroxy-2,5-dimethyloct-4-enylidene]-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol |
|---|---|
| PubChem CID | 101351566 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | (1S,3Z)-3-[(E,2R)-7-hydroxy-2,5-dimethyloct-4-enylidene]-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol |
| SMILES | C/C(=C\C[C@@H](C)/C=C1\CN2CCCCC2[C@@](C)(O)C1)CC(C)O |
| InChI | InChI=1S/C20H35NO2/c1-15(11-17(3)22)8-9-16(2)12-18-13-20(4,23)19-7-5-6-10-21(19)14-18/h8,12,16-17,19,22-23H,5-7,9-11,13-14H2,1-4H3/b15-8+,18-12-/t16-,17?,19?,20+/m1/s1 |
| InChIKey | DZLRSKDNIFLJHZ-WXUPUWKWSA-N |
| XLogP | 3.67 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|