C13H17F6N3O2S — CID 10135168
1-butyl-3-ethyl-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]urea (PubChem CID 10135168) has the molecular formula C13H17F6N3O2S and a molecular weight of 393.35 g/mol. Its IUPAC name is 1-butyl-3-ethyl-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-butyl-3-ethyl-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 10135168 |
| Molecular Formula | C13H17F6N3O2S |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 1-butyl-3-ethyl-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]urea |
| SMILES | CCCCN(C(=O)NCC)c1ncc(C(O)(C(F)(F)F)C(F)(F)F)s1 |
| InChI | InChI=1S/C13H17F6N3O2S/c1-3-5-6-22(9(23)20-4-2)10-21-7-8(25-10)11(24,12(14,15)16)13(17,18)19/h7,24H,3-6H2,1-2H3,(H,20,23) |
| InChIKey | FWRXCLCGFFDBTJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |