C21H32O4SSi — CID 101351791
methyl 2-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)sulfinylcyclopent-2-en-1-yl]acetate (PubChem CID 101351791) has the molecular formula C21H32O4SSi and a molecular weight of 408.64 g/mol. Its IUPAC name is methyl 2-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)sulfinylcyclopent-2-en-1-yl]acetate.
| Compound Name | methyl 2-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)sulfinylcyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 101351791 |
| Molecular Formula | C21H32O4SSi |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | methyl 2-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)sulfinylcyclopent-2-en-1-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C=C1S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H32O4SSi/c1-15-8-10-18(11-9-15)26(23)19-14-17(12-16(19)13-20(22)24-5)25-27(6,7)21(2,3)4/h8-11,14,16-17H,12-13H2,1-7H3/t16-,17+,26?/m1/s1 |
| InChIKey | YNJDBRLQKZKUOZ-XUKFFACESA-N |
| XLogP | 4.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|