C22H24O2 — CID 101351843
2-(3,4-dimethylphenyl)-3,5,6,7,8-pentamethylchromen-4-one (PubChem CID 101351843) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-3,5,6,7,8-pentamethylchromen-4-one.
| Compound Name | 2-(3,4-dimethylphenyl)-3,5,6,7,8-pentamethylchromen-4-one |
|---|---|
| PubChem CID | 101351843 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-3,5,6,7,8-pentamethylchromen-4-one |
| SMILES | Cc1ccc(-c2oc3c(C)c(C)c(C)c(C)c3c(=O)c2C)cc1C |
| InChI | InChI=1S/C22H24O2/c1-11-8-9-18(10-12(11)2)21-17(7)20(23)19-15(5)13(3)14(4)16(6)22(19)24-21/h8-10H,1-7H3 |
| InChIKey | SUXKSSUMXFGKIS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |