C23H20FN3O2 — CID 101351939
(1S,15S)-12-(4-fluorophenyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4,6,8-tetraene-14,20-dione (PubChem CID 101351939) has the molecular formula C23H20FN3O2 and a molecular weight of 389.43 g/mol. Its IUPAC name is (1S,15S)-12-(4-fluorophenyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4,6,8-tetraene-14,20-dione.
| Compound Name | (1S,15S)-12-(4-fluorophenyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4,6,8-tetraene-14,20-dione |
|---|---|
| PubChem CID | 101351939 |
| Molecular Formula | C23H20FN3O2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (1S,15S)-12-(4-fluorophenyl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4,6,8-tetraene-14,20-dione |
| SMILES | O=C1[C@@H]2Cc3c([nH]c4ccccc34)C(c3ccc(F)cc3)N2C(=O)[C@@H]2CCCN12 |
| InChI | InChI=1S/C23H20FN3O2/c24-14-9-7-13(8-10-14)21-20-16(15-4-1-2-5-17(15)25-20)12-19-22(28)26-11-3-6-18(26)23(29)27(19)21/h1-2,4-5,7-10,18-19,21,25H,3,6,11-12H2/t18-,19-,21?/m0/s1 |
| InChIKey | XDQWLYDUSSZVPG-CHEUHSMRSA-N |
| XLogP | 3.15 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|