C25H22O3 — CID 101352069
(3R,4S,5R)-4-benzoyl-3-hydroxy-3,5-diphenylcyclohexan-1-one (PubChem CID 101352069) has the molecular formula C25H22O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is (3R,4S,5R)-4-benzoyl-3-hydroxy-3,5-diphenylcyclohexan-1-one.
| Compound Name | (3R,4S,5R)-4-benzoyl-3-hydroxy-3,5-diphenylcyclohexan-1-one |
|---|---|
| PubChem CID | 101352069 |
| Molecular Formula | C25H22O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (3R,4S,5R)-4-benzoyl-3-hydroxy-3,5-diphenylcyclohexan-1-one |
| SMILES | O=C1C[C@@H](c2ccccc2)[C@H](C(=O)c2ccccc2)[C@@](O)(c2ccccc2)C1 |
| InChI | InChI=1S/C25H22O3/c26-21-16-22(18-10-4-1-5-11-18)23(24(27)19-12-6-2-7-13-19)25(28,17-21)20-14-8-3-9-15-20/h1-15,22-23,28H,16-17H2/t22-,23+,25-/m0/s1 |
| InChIKey | IEMFJHHANFICEQ-ARNLJNQMSA-N |
| XLogP | 4.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |