C14H14O2 — CID 101352147
(2R,3E,11E)-2-methoxytrideca-3,11-dien-5,7,9-triyn-1-ol (PubChem CID 101352147) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is (2R,3E,11E)-2-methoxytrideca-3,11-dien-5,7,9-triyn-1-ol.
| Compound Name | (2R,3E,11E)-2-methoxytrideca-3,11-dien-5,7,9-triyn-1-ol |
|---|---|
| PubChem CID | 101352147 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (2R,3E,11E)-2-methoxytrideca-3,11-dien-5,7,9-triyn-1-ol |
| SMILES | C/C=C/C#CC#CC#C/C=C/[C@H](CO)OC |
| InChI | InChI=1S/C14H14O2/c1-3-4-5-6-7-8-9-10-11-12-14(13-15)16-2/h3-4,11-12,14-15H,13H2,1-2H3/b4-3+,12-11+/t14-/m1/s1 |
| InChIKey | ITRUOZXYBLGQBS-DZLRQWJPSA-N |
| XLogP | 1.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|