C10H6OS4 — CID 101352467
3,7,9,13-tetrathiatetracyclo[6.6.0.02,6.010,14]tetradeca-2(6),4,10(14),11-tetraen-1-ol (PubChem CID 101352467) has the molecular formula C10H6OS4 and a molecular weight of 270.43 g/mol. Its IUPAC name is 3,7,9,13-tetrathiatetracyclo[6.6.0.02,6.010,14]tetradeca-2(6),4,10(14),11-tetraen-1-ol.
| Compound Name | 3,7,9,13-tetrathiatetracyclo[6.6.0.02,6.010,14]tetradeca-2(6),4,10(14),11-tetraen-1-ol |
|---|---|
| PubChem CID | 101352467 |
| Molecular Formula | C10H6OS4 |
| Molecular Weight | 270.43 g/mol |
| Exact Mass | 269.93 |
| IUPAC Name | 3,7,9,13-tetrathiatetracyclo[6.6.0.02,6.010,14]tetradeca-2(6),4,10(14),11-tetraen-1-ol |
| SMILES | OC12c3sccc3SC1Sc1ccsc12 |
| InChI | InChI=1S/C10H6OS4/c11-10-7-5(1-3-12-7)14-9(10)15-6-2-4-13-8(6)10/h1-4,9,11H |
| InChIKey | YPPPTCHWPYTIJF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |